CAS 90212-81-0

2-[[Bis(4-fluorophenyl)methyl]thio]acetic acid

Description:

2-[[Bis(4-fluorophenyl)methyl]thio]acetic acid is an organic compound characterized by its unique structure, which includes a thioether functional group and an acetic acid moiety. The presence of two 4-fluorophenyl groups attached to a sulfur atom contributes to its lipophilicity and potential biological activity. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic components, while its acidic group may impart some solubility in polar solvents. The fluorine substituents can enhance the compound's metabolic stability and influence its interaction with biological targets. As a thioacetic acid derivative, it may participate in various chemical reactions, including nucleophilic substitutions and esterifications. The compound's potential applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and reactivity. However, detailed studies would be necessary to fully elucidate its behavior in different environments and its potential uses in various fields.

Formula: C₁₅H₁₂F₂O₂S

InChI: InChI=1S/C15H12F2O2S/c16-12-5-1-10(2-6-12)15(20-9-14(18)19)11-3-7-13(17)8-4-11/h1-8,15H,9H2,(H,18,19)

InChI key: InChIKey=AKBHXBCMSOZXPR-UHFFFAOYSA-N

SMILES: C(SCC(O)=O)(C1=CC=C(F)C=C1)C2=CC=C(F)C=C2

Synonyms:

• 2-[[Bis(4-fluorophenyl)methyl]thio]acetic acid
• Acetic acid, [[bis(4-fluorophenyl)methyl]thio]-
• 2-[[Bis(4-fluorophenyl)methyl]sulfanyl]acetic acid
• Acetic acid, 2-[[bis(4-fluorophenyl)methyl]thio]-
• ([Bis(4-fluorophenyl)methyl]thio)acetic acid

Acetic acid, [[bis(4-fluorophenyl)methyl]thio]-

CAS: 90212-81-0

Formula: C₁₅H₁₂F₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 294.3164

Ref: IN-DA006J1A

2-((Bis(4-fluorophenyl)methyl)thio)acetic acid

CAS: 90212-81-0

2-((Bis(4-fluorophenyl)methyl)thio)acetic acid

Purity: 95%

Molecular weight: 294.32g/mol

Ref: 54-PC1003713