
CAS 902137-98-8
:3-(4-Bromo-2-methylphenyl)-2-propyn-1-ol
Description:
3-(4-Bromo-2-methylphenyl)-2-propyn-1-ol is an organic compound characterized by its unique structural features, including a brominated aromatic ring and a propyne functional group. The presence of the bromine atom introduces significant reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions or coupling reactions. The hydroxyl group (-OH) attached to the propyne moiety contributes to its polarity and solubility in polar solvents, while the aromatic ring enhances its stability and can influence its electronic properties. This compound may exhibit interesting biological activities due to its structural components, making it of interest in medicinal chemistry and material science. Additionally, its synthesis and reactivity can be explored in the context of organic synthesis, where it may serve as an intermediate or building block for more complex molecules. Overall, 3-(4-Bromo-2-methylphenyl)-2-propyn-1-ol presents a versatile framework for further chemical exploration and application.
Formula:C10H9BrO
InChI:InChI=1S/C10H9BrO/c1-8-7-10(11)5-4-9(8)3-2-6-12/h4-5,7,12H,6H2,1H3
InChI key:InChIKey=WXIANMVWUXRAMN-UHFFFAOYSA-N
SMILES:C(#CCO)C1=C(C)C=C(Br)C=C1
Synonyms:- 3-(4-Bromo-2-methylphenyl)-2-propyn-1-ol
- 2-Propyn-1-ol, 3-(4-bromo-2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.