CAS 902139-76-8
:(4,6,7-trimethyl-1-benzofuran-3-yl)acetic acid
Description:
(4,6,7-trimethyl-1-benzofuran-3-yl)acetic acid is an organic compound characterized by its unique structure, which includes a benzofuran moiety substituted with three methyl groups at the 4, 6, and 7 positions, along with an acetic acid functional group. This compound is likely to exhibit properties typical of both aromatic and carboxylic acid functionalities, such as potential acidity due to the carboxylic group and hydrophobic characteristics from the benzofuran structure. The presence of multiple methyl groups can influence its solubility, volatility, and reactivity, often enhancing lipophilicity. Additionally, the compound may possess biological activity, as many benzofuran derivatives are known for their pharmacological properties. Its molecular structure suggests it could participate in various chemical reactions, including esterification and acylation. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, (4,6,7-trimethyl-1-benzofuran-3-yl)acetic acid represents a complex organic molecule with potential applications in medicinal chemistry and material science.
Formula:C13H14O3
InChI:InChI=1/C13H14O3/c1-7-4-8(2)12-10(5-11(14)15)6-16-13(12)9(7)3/h4,6H,5H2,1-3H3,(H,14,15)
SMILES:Cc1cc(C)c2c(CC(=O)O)coc2c1C
Synonyms:- 3-Benzofuranacetic Acid, 4,6,7-Trimethyl-
- (4,6,7-Trimethyl-1-benzofuran-3-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
