CAS 90214-99-6

carbomethoxyethylthioethyl 4-O-(4-O-*(6-O-A-D-glu

Description:

Carbomethoxyethylthioethyl 4-O-(4-O-*(6-O-A-D-glu), identified by the CAS number 90214-99-6, is a chemical compound that features a complex structure typical of glycosylated compounds. It contains functional groups such as carbomethoxy, thioether, and glycosidic linkages, which contribute to its reactivity and solubility properties. The presence of a sugar moiety, specifically a glucose derivative, suggests potential biological activity, possibly in the context of drug delivery or as a biochemical probe. This compound may exhibit specific interactions with biological macromolecules, influencing its pharmacokinetics and pharmacodynamics. Its synthesis and characterization would typically involve techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm purity and structural integrity. The compound's applications could span various fields, including medicinal chemistry, biochemistry, and materials science, depending on its specific properties and reactivity. However, detailed studies would be necessary to fully elucidate its behavior in biological systems and potential therapeutic uses.

Formula: C₃₀H₅₂O₂₃S

InChI: InChI=1/C30H52O23S/c1-45-14(34)2-4-54-5-3-46-27-23(43)19(39)25(11(7-32)49-27)53-30-24(44)20(40)26(12(8-33)50-30)52-29-22(42)18(38)16(36)13(51-29)9-47-28-21(41)17(37)15(35)10(6-31)48-28/h10-13,15-33,35-44H,2-9H2,1H3

SMILES: COC(=O)CCSCCOC1C(C(C(C(CO)O1)OC1C(C(C(C(CO)O1)OC1C(C(C(C(COC2C(C(C(C(CO)O2)O)O)O)O1)O)O)O)O)O)O)O

Synonyms:

• Methyl 3-[(2-{[Hexopyranosyl-(1->6)Hexopyranosyl-(1->4)Hexopyranosyl-(1->4)Hexopyranosyl]Oxy}Ethyl)Sulfanyl]Propanoate

Carbomethoxyethylthioethyl 4-O-(4-O-[6-O-{a-D-glucopyranosyl}-a-D-glucopyranosyl]-a-D-glucopyranosyl)-b-D-glucopyranoside

CAS: 90214-99-6

Ref: 7W-GC9233

Carbomethoxyethylthioethyl 4-O-(4-O-[6-O-{a-D-glucopyranosyl}-a-D-glucopyranosyl]-a-D-glucopyranosyl)-b-D-glucopyranoside

CAS: 90214-99-6

Carbomethoxyethylthioethyl 4-O-(4-O-[6-O-{a-D-glucopyranosyl}-a-D-glucopyranosyl]-a-D-glucopyranosyl)-b-D-glucopyranoside is a synthetic carbohydrate with a molecular weight of 1406. It has been custom synthesized and modified to contain fluorine, methyl, and saccharide groups. Carbomethoxyethylthioethyl 4-O-(4 -O-[6 -O-[a -D - glucopyranosyl] - a - D - glucopyranosyl] - a - D - glucopyranosyl) b - D - glucopyranoside has been shown to be useful in the synthesis of oligosaccharides and polysaccharides.

Formula: C₃₀H₅₂O₂₃S

Purity: Min. 95%

Molecular weight: 812.79 g/mol

Ref: 3D-OC06493