CymitQuimica logo

CAS 90222-79-0

:

2-amino-5-(methylsulfonyl)benzoic acid

Description:
2-Amino-5-(methylsulfonyl)benzoic acid, also known as methanesulfonyl-2-amino-5-benzoic acid, is an organic compound characterized by its amino and sulfonyl functional groups attached to a benzoic acid structure. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and methanol, owing to the presence of the amino and sulfonyl groups, which enhance its hydrophilicity. It has potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of various bioactive compounds. The presence of the amino group allows for further derivatization, while the methylsulfonyl group can impart unique properties, such as increased solubility and stability. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure contributes to its reactivity and interaction with biological systems, which can be explored in drug development and other chemical applications. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H9NO4S
InChI:InChI=1/C8H9NO4S/c1-14(12,13)5-2-3-7(9)6(4-5)8(10)11/h2-4H,9H2,1H3,(H,10,11)
InChI key:UJEHBAYGWFHLKV-UHFFFAOYSA-N
SMILES:CS(=O)(=O)c1ccc(c(c1)C(=O)O)N
Synonyms:
  • Benzoic acid, 2-amino-5-(methylsulfonyl)-
  • 2-Amino-5-(methylsulfonyl)benzoic acid
Found 5 products.