CAS 90223-31-7
:5-amino-2-methyl-3-nitrobenzamide
Description:
5-Amino-2-methyl-3-nitrobenzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group, a methyl group, and a nitro group. The presence of the amino group (-NH2) indicates that it can act as a base, while the nitro group (-NO2) is known for its electron-withdrawing properties, influencing the compound's reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino and amide functional groups. It can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry. Additionally, its structural features suggest potential applications in pharmaceuticals or agrochemicals, where such functional groups can impart biological activity. Safety data should be consulted for handling, as nitro compounds can be sensitive and may pose health risks.
Formula:C8H9N3O3
InChI:InChI=1/C8H9N3O3/c1-4-6(8(10)12)2-5(9)3-7(4)11(13)14/h2-3H,9H2,1H3,(H2,10,12)
SMILES:Cc1c(cc(cc1N(=O)=O)N)C(=N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
