CAS 90224-21-8
:bromo-(2-ethylhexyl)magnesium
Description:
Bromo-(2-ethylhexyl)magnesium, with the CAS number 90224-21-8, is an organomagnesium compound that belongs to the class of Grignard reagents. These compounds are characterized by the presence of a carbon-magnesium bond, which is highly reactive and plays a crucial role in organic synthesis. Bromo-(2-ethylhexyl)magnesium is typically a colorless to light yellow liquid or solid, depending on its state and purity. It is known for its ability to act as a nucleophile, participating in various reactions such as nucleophilic addition to carbonyl compounds, which makes it valuable in the formation of carbon-carbon bonds. The presence of the bromo group enhances its reactivity, allowing it to readily react with electrophiles. However, due to its reactivity, it must be handled under an inert atmosphere, typically nitrogen or argon, to prevent decomposition or reaction with moisture and air. Safety precautions are essential when working with this compound, as it can be flammable and reactive with water, releasing flammable hydrocarbons.
Formula:C8H17BrMg
InChI:InChI=1/C8H17.BrH.Mg/c1-4-6-7-8(3)5-2;;/h8H,3-7H2,1-2H3;1H;/q;;+1/p-1/rC8H17BrMg/c1-3-5-6-8(4-2)7-10-9/h8H,3-7H2,1-2H3
SMILES:CCCCC([CH2])CC.Br.[Mg]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Ethylhexylmagnesium bromide 1M solution in DEE
CAS:2-Ethylhexylmagnesium bromide 1M solution in DEE
Molecular weight:217.43g/mol
