CAS 90224-83-2
:3-bromo-6-nitroquinolin-4-amine
Description:
3-Bromo-6-nitroquinolin-4-amine is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system. The presence of a bromine atom at the 3-position and a nitro group at the 6-position, along with an amino group at the 4-position, contributes to its unique reactivity and properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its aromatic nature. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity in electrophilic substitution reactions. Additionally, the amino group can participate in hydrogen bonding and may serve as a site for further chemical modifications. 3-Bromo-6-nitroquinolin-4-amine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. As with many nitro-containing compounds, it is important to handle this substance with care, considering its potential toxicity and environmental impact.
Formula:C9H6BrN3O2
InChI:InChI=1/C9H6BrN3O2/c10-7-4-12-8-2-1-5(13(14)15)3-6(8)9(7)11/h1-4H,(H2,11,12)
SMILES:c1cc2c(cc1N(=O)=O)c(=N)c(c[nH]2)Br
Synonyms:- 4-Quinolinamine, 3-Bromo-6-Nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
