CAS 90225-09-5
:5-chloroquinoline-8-sulfonic acid
Description:
5-Chloroquinoline-8-sulfonic acid is an organic compound characterized by its quinoline structure, which features a chlorine atom and a sulfonic acid group. This compound typically appears as a solid and is soluble in water due to the presence of the sulfonic acid group, which enhances its polarity. The chlorine substituent at the 5-position and the sulfonic acid group at the 8-position contribute to its unique chemical reactivity and potential applications. It is often used in biochemical research, particularly in studies involving enzyme inhibition and as a fluorescent probe due to its ability to interact with various biological molecules. The sulfonic acid group also makes it a strong acid, which can influence its behavior in different pH environments. Additionally, 5-chloroquinoline-8-sulfonic acid may exhibit antimicrobial properties, making it of interest in pharmaceutical and agricultural applications. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C9H6ClNO3S
InChI:InChI=1/C9H6ClNO3S/c10-7-3-4-8(15(12,13)14)9-6(7)2-1-5-11-9/h1-5H,(H,12,13,14)
SMILES:c1cc2c(ccc(c2nc1)S(=O)(=O)O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Chloroquinoline-8-sulfonic Acid
CAS:Controlled ProductApplications Used in the synthesis of 5-chloro-8-mercaptoquinoline and its salts.
Formula:C9H6ClNO3SColor and Shape:NeatMolecular weight:243.67
