CAS 90226-21-4
:N,1-dimethylcyclohexanamine hydrochloride
Description:
N,1-dimethylcyclohexanamine hydrochloride is a chemical compound characterized by its amine functional group and cyclohexane ring structure. It is a derivative of cyclohexanamine, where two methyl groups are attached to the nitrogen atom, enhancing its basicity and solubility in polar solvents. This compound typically appears as a white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which increases its stability and bioavailability. N,1-dimethylcyclohexanamine hydrochloride is often studied for its potential applications in pharmaceuticals and as a research chemical. Its structural features suggest it may interact with biological systems, potentially influencing neurotransmitter pathways. However, safety and handling precautions are essential, as with many amines, due to their potential for toxicity and reactivity. As with any chemical, proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is crucial for confirming its identity and purity in laboratory settings.
Formula:C8H18ClN
InChI:InChI=1/C8H17N.ClH/c1-8(9-2)6-4-3-5-7-8;/h9H,3-7H2,1-2H3;1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.