CAS 90226-87-2

(1-ethylpiperidin-4-yl)methanol

Description:

(1-Ethylpiperidin-4-yl)methanol is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features an ethyl group attached to the nitrogen atom of the piperidine ring, contributing to its unique properties. The presence of a hydroxymethyl group (-CH2OH) at the 4-position of the piperidine ring enhances its solubility in polar solvents and may influence its reactivity and biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperidine moiety's prevalence in various bioactive compounds. Additionally, the hydroxymethyl group may facilitate interactions with biological targets, making it a candidate for further research in drug design and synthesis. Safety data and handling precautions should be observed, as with all chemical substances, to ensure safe laboratory practices.

Formula: C₈H₁₇NO

InChI: InChI=1/C8H17NO/c1-2-9-5-3-8(7-10)4-6-9/h8,10H,2-7H2,1H3

SMILES: CCN1CCC(CC1)CO

(1-Ethylpiperidin-4-yl)methanol

CAS: 90226-87-2

Formula: C₈H₁₇NO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 143.2267

Ref: IN-DA00GTSE

(1-Ethylpiperidin-4-yl)methanol

CAS: 90226-87-2

(1-Ethylpiperidin-4-yl)methanol

Purity: 95%

Molecular weight: 143.23g/mol

Ref: 54-OR903901

(1-Ethylpiperidin-4-yl)methanol

CAS: 90226-87-2

Formula: C₈H₁₇NO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 143.23

Ref: 10-F078247

(1-Ethylpiperidin-4-yl)methanol

CAS: 90226-87-2

1-Ethylpiperidin-4-yl)methanol (1EPPM) is a high quality, versatile building block. It is a useful intermediate for the synthesis of other compounds, and it can be used as a reaction component in the synthesis of various complex compounds. 1EPPM is also an excellent reagent for research purposes. CAS No.: 90226-87-2

Formula: C₈H₁₇NO

Purity: Min. 95%

Color and Shape: Clear Liquid

Molecular weight: 143.23 g/mol

Ref: 3D-FE143765