CAS 90227-42-2

[1-(2-methoxyethyl)pyrrolidin-3-yl]methanol

Description:

[1-(2-methoxyethyl)pyrrolidin-3-yl]methanol, with the CAS number 90227-42-2, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a methanol group and a 2-methoxyethyl substituent, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the methanol group suggests potential for hydrogen bonding, which may influence its solubility in polar solvents. Additionally, the methoxyethyl group can enhance lipophilicity, affecting its interaction with biological membranes. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and reactivity can be influenced by the functional groups present, allowing for various applications in organic synthesis and potential therapeutic uses. As with any chemical, safety and handling precautions should be observed, particularly regarding its stability and reactivity under different conditions.

Formula: C₈H₁₇NO₂

InChI: InChI=1/C8H17NO2/c1-11-5-4-9-3-2-8(6-9)7-10/h8,10H,2-7H2,1H3

SMILES: COCCN1CCC(C1)CO

Synonyms:

• 3-Pyrrolidinemethanol, 1-(2-Methoxyethyl)-

[1-(2-Methoxyethyl)pyrrolidin-3-yl]methanol

CAS: 90227-42-2

Formula: C₈H₁₇NO₂

Molecular weight: 159.2261

Ref: IN-DA006IMF

[1-(2-methoxyethyl)pyrrolidin-3-yl]methanol

CAS: 90227-42-2

Formula: C₈H₁₇NO₂

Purity: 95.0%

Molecular weight: 159.229

Ref: 10-F310325