CymitQuimica logo

CAS 90247-09-9

:

8-chloro-3-(2-fluorophenyl)-5,6-dihydrofuro[3,2-f][1,2]benzoxazole-6-carboxylic acid

Description:
8-Chloro-3-(2-fluorophenyl)-5,6-dihydrofuro[3,2-f][1,2]benzoxazole-6-carboxylic acid is a complex organic compound characterized by its unique structural features, which include a fused benzoxazole and furo moiety. This compound contains a chloro substituent and a fluorophenyl group, contributing to its potential biological activity and chemical reactivity. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The fused ring system may impart rigidity to the molecule, affecting its conformational properties and interactions with biological targets. Additionally, the halogen substituents (chlorine and fluorine) can enhance lipophilicity and influence pharmacokinetic properties, making this compound of interest in medicinal chemistry. Its specific applications and biological activities would depend on further studies, including its synthesis, stability, and interactions with other molecules. Overall, this compound exemplifies the complexity and diversity of organic molecules in pharmaceutical research.
Formula:C16H9ClFNO4
InChI:InChI=1/C16H9ClFNO4/c17-12-14-7(6-11(22-14)16(20)21)5-9-13(19-23-15(9)12)8-3-1-2-4-10(8)18/h1-5,11H,6H2,(H,20,21)
SMILES:c1ccc(c(c1)c1c2cc3CC(C(=O)O)Oc3c(c2on1)Cl)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.