CymitQuimica logo

CAS 902518-41-6

:

3-Fluoro-4-(methylthio)pyridine

Description:
3-Fluoro-4-(methylthio)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a fluorine atom at the 3-position and a methylthio group at the 4-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits moderate polarity due to the electronegative fluorine and sulfur atoms, which can influence its solubility in various solvents. The methylthio group can enhance its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 3-Fluoro-4-(methylthio)pyridine may have applications in medicinal chemistry and agrochemicals, as modifications of pyridine derivatives are often explored for their biological activities. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled.
Formula:C6H6FNS
InChI:InChI=1S/C6H6FNS/c1-9-6-2-3-8-4-5(6)7/h2-4H,1H3
InChI key:InChIKey=RHMGQKJWGKVPES-UHFFFAOYSA-N
SMILES:S(C)C=1C(F)=CN=CC1
Synonyms:
  • 3-Fluoro-4-(methylthio)pyridine
  • 3-Fluoro-4-methylsulfanylpyridine
  • 3-Fluoro-4-(methylsulfanyl)pyridine
  • Pyridine, 3-fluoro-4-(methylthio)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.