CymitQuimica logo

CAS 902518-44-9

:

(3-fluoro-2-pyridyl)-phenyl-methanone

Description:
(3-Fluoro-2-pyridyl)-phenyl-methanone, identified by its CAS number 902518-44-9, is an organic compound characterized by the presence of a pyridine ring and a phenyl group connected through a carbonyl (ketone) functional group. The structure features a fluorine atom substituted at the 3-position of the pyridine ring, which can influence the compound's reactivity and polarity. This compound is likely to exhibit properties typical of ketones, such as being a polar molecule with potential for hydrogen bonding due to the carbonyl group. Its unique structure may impart specific biological or chemical activity, making it of interest in pharmaceutical or agrochemical research. The presence of both the pyridine and phenyl groups suggests potential applications in medicinal chemistry, where such compounds can serve as intermediates or active pharmaceutical ingredients. Additionally, the fluorine substitution can enhance lipophilicity and metabolic stability, which are valuable traits in drug design. Overall, this compound's characteristics make it a subject of interest for further study in various chemical and biological contexts.
Formula:C12H8FNO
InChI:InChI=1/C12H8FNO/c13-10-7-4-8-14-11(10)12(15)9-5-2-1-3-6-9/h1-8H
SMILES:c1ccc(cc1)C(=O)c1c(cccn1)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.