CymitQuimica logo

CAS 90253-21-7

:

1H-Pyrazole, 4-cyclopropyl-

Description:
1H-Pyrazole, 4-cyclopropyl- is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. The presence of a cyclopropyl group at the 4-position of the pyrazole ring contributes to its unique chemical properties and potential reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its applications in medicinal chemistry and as a building block in the synthesis of various pharmaceuticals and agrochemicals. The compound may exhibit biological activity, making it of interest in drug development. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and stability. As with many nitrogen-containing heterocycles, 1H-Pyrazole, 4-cyclopropyl- may also participate in electrophilic and nucleophilic reactions, expanding its utility in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H8N2
InChI:InChI=1S/C6H8N2/c1-2-5(1)6-3-7-8-4-6/h3-5H,1-2H2,(H,7,8)
InChI key:FHHRJUAWRYSTJL-UHFFFAOYSA-N
SMILES:C1CC1C2=CNN=C2
Found 4 products.