CymitQuimica logo

CAS 90253-23-9

:

4-Cycloheptyl-1H-pyrazole

Description:
4-Cycloheptyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of the cycloheptyl group, a seven-membered carbon ring, contributes to its unique properties and potential applications. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The molecular structure allows for various interactions, including hydrogen bonding and hydrophobic interactions, which can influence its reactivity and solubility in different solvents. Additionally, 4-Cycloheptyl-1H-pyrazole may exhibit specific pharmacological effects, although detailed studies are necessary to fully understand its mechanisms and potential therapeutic uses. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if ingested or improperly handled.
Formula:C10H16N2
InChI:InChI=1S/C10H16N2/c1-2-4-6-9(5-3-1)10-7-11-12-8-10/h7-9H,1-6H2,(H,11,12)
InChI key:InChIKey=APCXXGYOSOLREP-UHFFFAOYSA-N
SMILES:C=1(C=NNC1)C2CCCCCC2
Synonyms:
  • 1H-Pyrazole, 4-cycloheptyl-
  • 4-Cycloheptyl-1H-pyrazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.