
CAS 90253-44-4
:5-Cyclopentyl-2-pyrimidinamine
Description:
5-Cyclopentyl-2-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 2 and 4. The presence of a cyclopentyl group at the 5-position of the pyrimidine ring contributes to its unique properties, including potential hydrophobic interactions due to the aliphatic nature of the cyclopentyl moiety. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its amine functional group can participate in hydrogen bonding, influencing its solubility and reactivity. The molecular structure suggests potential applications in various fields, including drug design and synthesis. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and the presence of other functional groups. Overall, 5-Cyclopentyl-2-pyrimidinamine represents a versatile scaffold for further chemical exploration and development.
Formula:C9H13N3
InChI:InChI=1S/C9H13N3/c10-9-11-5-8(6-12-9)7-3-1-2-4-7/h5-7H,1-4H2,(H2,10,11,12)
InChI key:InChIKey=OCXDNNZPMPHTOX-UHFFFAOYSA-N
SMILES:NC=1N=CC(=CN1)C2CCCC2
Synonyms:- 2-Pyrimidinamine, 5-cyclopentyl-
- 5-Cyclopentyl-2-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.