CAS 90259-27-1
:2-Fluoro-6-methylbenzoic acid
Description:
2-Fluoro-6-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a methyl group on a benzoic acid structure. The fluorine atom is located at the second position, while the methyl group is at the sixth position of the benzene ring, contributing to its unique chemical properties. This compound typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification and amidation. The presence of the fluorine atom can influence the compound's reactivity and polarity, making it useful in synthetic organic chemistry and pharmaceuticals. Additionally, 2-fluoro-6-methylbenzoic acid may serve as an intermediate in the synthesis of more complex molecules, highlighting its significance in chemical research and industrial applications.
Formula:C8H7FO2
InChI:InChI=1/C8H7FO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11)
SMILES:Cc1cccc(c1C(=O)O)F
Synonyms:- Benzoic acid, 2-fluoro-6-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Fluoro-6-methylbenzoic acid
CAS:Formula:C8H7FO2Purity:97%Color and Shape:SolidMolecular weight:154.1384Ref: IN-DA0033BI
1kgTo inquire5kgTo inquire500gTo inquire1g20.00€250mg22.00€5g47.00€10g68.00€25g108.00€100g298.00€2-Fluoro-6-methylbenzoic acid
CAS:2-Fluoro-6-methylbenzoic acidFormula:C8H7FO2Purity:98%Color and Shape: white powderMolecular weight:154.14g/mol2-Fluoro-6-methylbenzoic acid
CAS:Formula:C8H7FO2Purity:97%Color and Shape:SolidMolecular weight:154.142-Fluoro-6-methylbenzoic acid
CAS:Please enquire for more information about 2-Fluoro-6-methylbenzoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C8H7FO2Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:154.14 g/mol



