CAS 90268-18-1
:Boric acid (H3BO3), reaction products with glycerol, potassium salts
Description:
Boric acid (H3BO3) is a weak acid that exhibits unique properties, making it useful in various applications, including as an antiseptic, insecticide, and pH buffer. When reacted with glycerol, boric acid can form borate esters, which are often utilized in the production of boron-containing compounds. These reactions typically involve the dehydration of glycerol and the formation of a boron-glycerol complex, enhancing the solubility and stability of the resulting products. The potassium salts of boric acid, such as potassium borate, are formed through the neutralization of boric acid with potassium hydroxide or potassium carbonate. These salts are characterized by their solubility in water and are often used in agricultural applications as fertilizers or in glass manufacturing due to their ability to improve thermal and mechanical properties. Overall, the combination of boric acid with glycerol and potassium salts leads to a range of products with diverse applications in industry and agriculture, highlighting the versatility of boron chemistry.
Formula:C3H8O3·BH3O3
InChI:InChI=1S/C3H8O3.BH3O3/c4-1-3(6)2-5;2-1(3)4/h3-6H,1-2H2;2-4H
InChI key:InChIKey=PEEKVIHQOHJITP-UHFFFAOYSA-N
SMILES:B(O)(O)O.C(CO)(CO)O
Synonyms:- Boric acid (H3BO3), reaction products with glycerol, potassium salts
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boric acid (H3BO3), reaction products with glycerol, potassium salts
CAS:Formula:C3H11Bo6Molecular weight:153.9268 G/Mol
