CAS 90268-78-3

2-Butyne-1,4-diol, reaction products with 1,2-oxathiolane 2,2-dioxide and sodium hydroxide

Description:

2-Butyne-1,4-diol, reaction products with 1,2-oxathiolane 2,2-dioxide and sodium hydroxide, identified by CAS number 90268-78-3, is a chemical compound that typically exhibits characteristics associated with its functional groups. This substance likely contains hydroxyl (-OH) groups due to the presence of 2-butyne-1,4-diol, which can impart hydrophilicity and reactivity in various chemical reactions. The oxathiolane moiety suggests the presence of a sulfur atom in a cyclic structure, which may contribute to unique chemical properties, such as potential nucleophilicity or stability under certain conditions. The reaction with sodium hydroxide indicates that the compound may participate in base-catalyzed reactions, possibly leading to the formation of various derivatives or polymeric structures. Overall, the compound's characteristics would include solubility in polar solvents, potential reactivity with electrophiles, and the ability to undergo further transformations depending on the reaction conditions. Its applications may span across fields such as organic synthesis, materials science, and pharmaceuticals, depending on the specific properties and reactivity of the resulting products.

Formula: C₄H₆O₂·C₃H₆O₃S·HNaO

InChI: InChI=1S/C4H6O2.C3H6O3S.Na.H2O/c5-3-1-2-4-6;4-7(5)3-1-2-6-7;;/h5-6H,3-4H2;1-3H2;;1H2/q;;+1;/p-1

InChI key: InChIKey=GTQAZEMBTGFLSB-UHFFFAOYSA-M

SMILES: [Na]O.O=S1(=O)CCCO1.C(#CCO)CO

Synonyms:

• 2-Butyne-1,4-diol -(3-sulfopropyl)ether, sodium salt
• 2-Butyne-1,4-diol, reaction products with 1,2-oxathiolane 2,2-dioxide and sodium hydroxide
• 3-(Butynediol) sulfopropyl ether, monosodium salt
• Butynediol Sulfopropyl Ether Sodium
• Sulfopropylated 2 Butyne-1,4-diol, sodium -salt

Butynediol sulfopropyl ethersodium

Controlled Product

CAS: 90268-78-3

Please enquire for more information about Butynediol sulfopropyl ethersodium including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₇H₁₁NaO₅S

Purity: Min. 95%

Molecular weight: 230.22 g/mol

Ref: 3D-FB150881