CAS 90272-09-6

8-Chloro-4-hydroxy-3-cinnolinecarboxylic acid

Description:

8-Chloro-4-hydroxy-3-cinnolinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a chloro group, a hydroxyl group, and a cinnoline moiety. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it a potential candidate for various chemical reactions and applications. The presence of the chloro substituent can influence its reactivity and solubility, while the hydroxyl group may contribute to hydrogen bonding capabilities. As a carboxylic acid, it can participate in acid-base reactions, and its aromatic nature may allow for electrophilic substitution reactions. This compound is of interest in medicinal chemistry and may have potential applications in pharmaceuticals or agrochemicals due to its biological activity. Additionally, its specific interactions with biological targets can be explored for therapeutic purposes. Overall, 8-Chloro-4-hydroxy-3-cinnolinecarboxylic acid represents a versatile structure with potential implications in various fields of research.

Formula: C₉H₅ClN₂O₃

InChI: InChI=1S/C9H5ClN2O3/c10-5-3-1-2-4-6(5)11-12-7(8(4)13)9(14)15/h1-3H,(H,11,13)(H,14,15)

InChI key: InChIKey=PVBRPYULLYDLKC-UHFFFAOYSA-N

SMILES: OC=1C2=C(N=NC1C(O)=O)C(Cl)=CC=C2

Synonyms:

• 3-Cinnolinecarboxylic acid, 8-chloro-4-hydroxy-
• 8-Chloro-4-hydroxy-3-cinnolinecarboxylic acid

8-Chloro-4-oxo-1,4-dihydrocinnoline-3-carboxylic acid

CAS: 90272-09-6

Formula: C₉H₅ClN₂O₃

Molecular weight: 224.6006

Ref: IN-DA006H9J