CymitQuimica logo

CAS 902742-37-4

:

α-Cyclopropyl-2,3-dihydro-1,4-benzodioxin-6-methanamine

Description:
α-Cyclopropyl-2,3-dihydro-1,4-benzodioxin-6-methanamine is a chemical compound characterized by its unique bicyclic structure, which includes a benzodioxin moiety and a cyclopropyl group. This compound features a methanamine functional group, contributing to its potential reactivity and biological activity. The presence of the cyclopropyl ring often imparts distinctive steric and electronic properties, which can influence the compound's interactions with biological targets. The benzodioxin structure is known for its stability and can participate in various chemical reactions, making it of interest in medicinal chemistry and drug design. Additionally, the compound may exhibit specific pharmacological properties, although detailed studies would be necessary to elucidate its biological effects and mechanisms of action. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Overall, α-Cyclopropyl-2,3-dihydro-1,4-benzodioxin-6-methanamine represents a fascinating area of study within organic and medicinal chemistry.
Formula:C12H15NO2
InChI:InChI=1S/C12H15NO2/c13-12(8-1-2-8)9-3-4-10-11(7-9)15-6-5-14-10/h3-4,7-8,12H,1-2,5-6,13H2
InChI key:InChIKey=UZOVCJLWNHBMIQ-UHFFFAOYSA-N
SMILES:C(N)(C=1C=C2C(=CC1)OCCO2)C3CC3
Synonyms:
  • α-Cyclopropyl-2,3-dihydro-1,4-benzodioxin-6-methanamine
  • 1,4-Benzodioxin-6-methanamine, α-cyclopropyl-2,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.