CAS 902765-49-5

Ethyl 5-bromo-3-iodo-1H-indole-2-carboxylate

Description:

Ethyl 5-bromo-3-iodo-1H-indole-2-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features both bromine and iodine substituents, which are halogens that can significantly influence its reactivity and biological activity. The presence of the ethyl ester group at the carboxylate position enhances its solubility in organic solvents and may affect its pharmacokinetic properties. The compound is likely to exhibit interesting chemical behavior due to the electron-withdrawing effects of the halogens, which can stabilize certain reactive intermediates. Additionally, the indole moiety is known for its occurrence in various natural products and pharmaceuticals, suggesting potential applications in medicinal chemistry. Overall, Ethyl 5-bromo-3-iodo-1H-indole-2-carboxylate is a compound of interest for further research, particularly in the fields of organic synthesis and drug development.

Formula: C₁₁H₉BrINO₂

InChI: InChI=1S/C11H9BrINO2/c1-2-16-11(15)10-9(13)7-5-6(12)3-4-8(7)14-10/h3-5,14H,2H2,1H3

InChI key: InChIKey=VVLJZDDKWVXPJE-UHFFFAOYSA-N

SMILES: IC=1C=2C(NC1C(OCC)=O)=CC=C(Br)C2

Synonyms:

• 1H-Indole-2-carboxylic acid, 5-bromo-3-iodo-, ethyl ester
• 5-Bromo-3-iodoindole-2-carboxylic acid ethyl ester
• Ethyl 5-bromo-3-iodo-1H-indole-2-carboxylate