CAS 90283-09-3
:1-O-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoyl]-beta-D-glucopyranuronic acid
Description:
1-O-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoyl]-beta-D-glucopyranuronic acid is a complex organic compound characterized by its unique structural features, which include a glucopyranuronic acid moiety linked to a propanoyl group that is further substituted with a 4,5-diphenyl-1,3-oxazole ring. This compound exhibits properties typical of both carbohydrate derivatives and heterocyclic compounds, potentially influencing its solubility, reactivity, and biological activity. The presence of the oxazole ring suggests potential applications in medicinal chemistry, as oxazole derivatives are often explored for their pharmacological properties. Additionally, the glucopyranuronic acid component may impart specific interactions with biological systems, such as enzyme recognition or cellular uptake. The compound's molecular structure indicates it may participate in hydrogen bonding and other intermolecular interactions, which could affect its stability and behavior in various environments. Overall, this compound represents a fascinating intersection of carbohydrate chemistry and heterocyclic chemistry, with potential implications in drug design and development.
Formula:C24H23NO9
InChI:InChI=1/C24H23NO9/c26-16(33-24-20(29)18(27)19(28)22(34-24)23(30)31)12-11-15-25-17(13-7-3-1-4-8-13)21(32-15)14-9-5-2-6-10-14/h1-10,18-20,22,24,27-29H,11-12H2,(H,30,31)/t18-,19-,20+,22-,24+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Oxaprozin Acyl Glucuronide
CAS:Formula:C24H23NO9Color and Shape:White To Off-White SolidMolecular weight:469.45Oxaprozin Glucuronide
CAS:Controlled ProductFormula:C24H23NO9Color and Shape:NeatMolecular weight:469.441



