
CAS 902835-75-0
:N,N,N'-Trimethyltetrahydro-3,4-furandiamine
Description:
N,N,N'-Trimethyltetrahydro-3,4-furandiamine is an organic compound characterized by its unique structure, which includes a furan ring and multiple amine groups. This compound features a tetrahydro-furan moiety, indicating that it has undergone hydrogenation, resulting in a saturated ring structure. The presence of three methyl groups attached to the nitrogen atoms contributes to its overall stability and solubility in various solvents. Typically, compounds like this may exhibit properties such as being hygroscopic and having moderate to high polarity due to the amine functionalities. The amine groups can participate in hydrogen bonding, which can influence the compound's reactivity and interactions with other molecules. Additionally, the furan ring may impart some degree of aromatic character, affecting its electronic properties. This compound may find applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its potential as a building block in various chemical reactions. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C7H16N2O
InChI:InChI=1S/C7H16N2O/c1-8-6-4-10-5-7(6)9(2)3/h6-8H,4-5H2,1-3H3
SMILES:CNC1COCC1N(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
