CAS 902836-16-2
:N-Ethyl-2-(1-piperazinyl)-3-pyridinecarboxamide
Description:
N-Ethyl-2-(1-piperazinyl)-3-pyridinecarboxamide, identified by its CAS number 902836-16-2, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a piperazine moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amide functional group. The ethyl group contributes to its lipophilicity, which may influence its biological activity and pharmacokinetic properties. N-Ethyl-2-(1-piperazinyl)-3-pyridinecarboxamide may interact with various biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and form of the compound. Overall, this substance is a representative of a class of compounds that may exhibit diverse biological activities, warranting further investigation in drug discovery and development contexts.
Formula:C12H18N4O
InChI:InChI=1S/C12H18N4O/c1-2-14-12(17)10-4-3-5-15-11(10)16-8-6-13-7-9-16/h3-5,13H,2,6-9H2,1H3,(H,14,17)
InChI key:InChIKey=JYFVWJXFJQURPD-UHFFFAOYSA-N
SMILES:C(NCC)(=O)C1=C(N=CC=C1)N2CCNCC2
Synonyms:- N-Ethyl-2-(1-piperazinyl)-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, N-ethyl-2-(1-piperazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.