CAS 902836-34-4

1-[4-(Methylamino)-1-piperidinyl]-1-propanone

Description:

1-[4-(Methylamino)-1-piperidinyl]-1-propanone, also known by its CAS number 902836-34-4, is a chemical compound that belongs to the class of substituted piperidines. This substance features a piperidine ring substituted with a methylamino group and a propanone moiety, which contributes to its potential biological activity. It is typically characterized by its molecular structure, which includes a piperidine ring, a ketone functional group, and an amine substituent. The presence of the methylamino group may influence its pharmacological properties, potentially affecting its interaction with biological targets such as neurotransmitter receptors. This compound is of interest in medicinal chemistry and research, particularly in the context of developing new therapeutic agents. However, detailed information regarding its specific physical and chemical properties, such as solubility, melting point, and stability, would require further investigation or experimental data. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₉H₁₈N₂O

InChI: InChI=1S/C9H18N2O/c1-3-9(12)11-6-4-8(10-2)5-7-11/h8,10H,3-7H2,1-2H3

InChI key: InChIKey=RRUSDXAHDXKSFA-UHFFFAOYSA-N

SMILES: C(CC)(=O)N1CCC(NC)CC1

Synonyms:

• 1-Propanone, 1-[4-(methylamino)-1-piperidinyl]-
• 1-[4-(Methylamino)-1-piperidinyl]-1-propanone