CymitQuimica logo

CAS 902836-48-0

:

1-(4-Amino-1-piperidinyl)-3-methyl-1-butanone

Description:
1-(4-Amino-1-piperidinyl)-3-methyl-1-butanone, identified by its CAS number 902836-48-0, is a chemical compound that features a piperidine ring, which is a six-membered ring containing one nitrogen atom. This compound is characterized by the presence of an amino group, which contributes to its basicity and potential reactivity. The structure includes a butanone moiety, indicating that it has a ketone functional group, which can participate in various chemical reactions, such as nucleophilic additions. The methyl group attached to the butanone enhances its hydrophobic character, influencing its solubility and interaction with biological systems. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H20N2O
InChI:InChI=1S/C10H20N2O/c1-8(2)7-10(13)12-5-3-9(11)4-6-12/h8-9H,3-7,11H2,1-2H3
InChI key:InChIKey=ZAFPTTKRKHUWPN-UHFFFAOYSA-N
SMILES:C(CC(C)C)(=O)N1CCC(N)CC1
Synonyms:
  • 1-(4-Amino-1-piperidinyl)-3-methyl-1-butanone
  • 1-Butanone, 1-(4-amino-1-piperidinyl)-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.