CAS 902836-49-1
:4-[2-(Trifluoromethoxy)phenoxy]piperidine
Description:
4-[2-(Trifluoromethoxy)phenoxy]piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a phenoxy group substituted with a trifluoromethoxy moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the trifluoromethoxy group enhances lipophilicity and may influence the compound's interaction with biological targets, making it of interest in medicinal chemistry. It is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting various neurological or psychiatric conditions. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its solubility and stability. Safety and handling precautions are essential when working with this substance, as the trifluoromethoxy group can impart specific toxicological properties. Overall, 4-[2-(Trifluoromethoxy)phenoxy]piperidine represents a valuable compound for research and development in chemical and pharmaceutical sciences.
Formula:C12H14F3NO2
InChI:InChI=1/C12H14F3NO2/c13-12(14,15)18-11-4-2-1-3-10(11)17-9-5-7-16-8-6-9/h1-4,9,16H,5-8H2
InChI key:InChIKey=UXSFSVYZILNPEV-UHFFFAOYSA-N
SMILES:O(C1=C(OC(F)(F)F)C=CC=C1)C2CCNCC2
Synonyms:- Piperidine, 4-[2-(Trifluoromethoxy)Phenoxy]-
- 4-[2-(Trifluoromethoxy)phenoxy]piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
