
CAS 902836-52-6
:3-Methoxy-4-(3-piperidinyloxy)benzonitrile
Description:
3-Methoxy-4-(3-piperidinyloxy)benzonitrile, with the CAS number 902836-52-6, is a chemical compound characterized by its complex structure, which includes a methoxy group, a piperidinyloxy moiety, and a benzonitrile framework. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the methoxy group can enhance lipophilicity, potentially influencing its solubility and permeability in biological systems. The piperidine ring may impart basicity and contribute to interactions with biological targets, such as receptors or enzymes. As a nitrile, it may also exhibit reactivity characteristic of this functional group, including potential participation in nucleophilic addition reactions. Overall, the unique combination of functional groups in 3-Methoxy-4-(3-piperidinyloxy)benzonitrile suggests that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or other disorders. However, specific biological activity and safety profiles would require further investigation through empirical studies.
Formula:C13H16N2O2
InChI:InChI=1S/C13H16N2O2/c1-16-13-7-10(8-14)4-5-12(13)17-11-3-2-6-15-9-11/h4-5,7,11,15H,2-3,6,9H2,1H3
InChI key:InChIKey=DQDILUBZRNIFAM-UHFFFAOYSA-N
SMILES:O(C1=C(OC)C=C(C#N)C=C1)C2CCCNC2
Synonyms:- 3-Methoxy-4-(3-piperidinyloxy)benzonitrile
- Benzonitrile, 3-methoxy-4-(3-piperidinyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.