CAS 902836-56-0

Tetrahydro-4-[3-(trifluoromethyl)phenyl]-2H-pyran-4-carboxaldehyde

Description:

Tetrahydro-4-[3-(trifluoromethyl)phenyl]-2H-pyran-4-carboxaldehyde is an organic compound characterized by its unique structural features, including a pyran ring and a trifluoromethyl-substituted phenyl group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. This compound typically exhibits a colorless to pale yellow appearance and is soluble in organic solvents, which is common for many pyran derivatives. Its aldehyde functional group is reactive, making it a potential candidate for further chemical transformations, such as condensation reactions or nucleophilic additions. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the pyran and aldehyde functionalities, which are often found in biologically active molecules. Additionally, the trifluoromethyl group can impart unique electronic properties, potentially enhancing the compound's interaction with biological targets. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and reactivity.

Formula: C₁₃H₁₃F₃O₂

InChI: InChI=1S/C13H13F3O2/c14-13(15,16)11-3-1-2-10(8-11)12(9-17)4-6-18-7-5-12/h1-3,8-9H,4-7H2

InChI key: InChIKey=DTPGZXZHZSJJBT-UHFFFAOYSA-N

SMILES: C(=O)C1(CCOCC1)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• 4-[3-(Trifluoromethyl)phenyl]tetrahydro-2H-pyran-4-carboxaldehyde
• Tetrahydro-4-[3-(trifluoromethyl)phenyl]-2H-pyran-4-carboxaldehyde
• 2H-Pyran-4-carboxaldehyde, tetrahydro-4-[3-(trifluoromethyl)phenyl]-