CAS 902836-58-2

4-(o-tolyl)tetrahydropyran-4-carbaldehyde

Description:

4-(o-Tolyl)tetrahydropyran-4-carbaldehyde is an organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. The presence of the o-tolyl group indicates that there is a methyl group attached to the aromatic ring, specifically in the ortho position relative to the aldehyde functional group. This compound features a carbonyl group (aldehyde) at the 4-position of the tetrahydropyran, contributing to its reactivity and potential applications in organic synthesis. The molecular structure suggests that it may exhibit properties typical of both cyclic ethers and aldehydes, such as being a potential electrophile in nucleophilic addition reactions. Additionally, the presence of the aromatic o-tolyl group may influence its solubility, stability, and interaction with other chemical species. Overall, 4-(o-tolyl)tetrahydropyran-4-carbaldehyde is of interest in synthetic organic chemistry, particularly in the development of more complex molecules or as an intermediate in various chemical reactions.

Formula: C₁₃H₁₆O₂

InChI: InChI=1/C13H16O2/c1-11-4-2-3-5-12(11)13(10-14)6-8-15-9-7-13/h2-5,10H,6-9H2,1H3

Synonyms:

• 2H-pyran-4-carboxaldehyde, tetrahydro-4-(2-methylphenyl)-
• 4-(2-methylphenyl)tetrahydro-2H-pyran-4-carbaldehyde