CAS 902836-60-6
:4-(3-Chlorophenyl)tetrahydro-2H-pyran-4-carboxaldehyde
Description:
4-(3-Chlorophenyl)tetrahydro-2H-pyran-4-carboxaldehyde is an organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. The presence of a carboxaldehyde functional group indicates that it has an aldehyde moiety, contributing to its reactivity and potential applications in organic synthesis. The 3-chlorophenyl substituent introduces both electron-withdrawing and steric effects, which can influence the compound's reactivity and interaction with biological targets. This compound may exhibit properties typical of aldehydes, such as being a potential electrophile in nucleophilic addition reactions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the presence of the chlorine atom may enhance lipophilicity and influence the compound's biological activity. Overall, 4-(3-Chlorophenyl)tetrahydro-2H-pyran-4-carboxaldehyde is a versatile compound with interesting chemical properties that warrant further investigation in various chemical and biological contexts.
Formula:C12H13ClO2
InChI:InChI=1/C12H13ClO2/c13-11-3-1-2-10(8-11)12(9-14)4-6-15-7-5-12/h1-3,8-9H,4-7H2
SMILES:c1cc(cc(c1)Cl)C1(CCOCC1)C=O
Synonyms:- 2H-pyran-4-carboxaldehyde, 4-(3-chlorophenyl)tetrahydro-
- 4-(3-chlorophenyl)tetrahydro-2H-pyran-4-carbaldehyde
- 4-(3-Chlorophenyl)Tetrahydropyran-4-Carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
