CAS 902836-70-8
:2-(2,4-Difluorophenoxy)-5-fluoro-N-methylbenzenemethanamine
Description:
2-(2,4-Difluorophenoxy)-5-fluoro-N-methylbenzenemethanamine, with the CAS number 902836-70-8, is a chemical compound characterized by its complex structure, which includes a phenoxy group and multiple fluorine substituents. This compound typically exhibits properties associated with aromatic amines, such as potential biological activity and solubility characteristics influenced by the presence of fluorine atoms. The fluorine substituents can enhance lipophilicity and metabolic stability, making it of interest in pharmaceutical research. The presence of the methyl group on the nitrogen atom may affect its basicity and reactivity. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. As with many fluorinated compounds, it may also exhibit unique physical and chemical properties, such as altered boiling and melting points compared to non-fluorinated analogs. Safety and handling considerations should be taken into account, as with all chemical substances, particularly those with potential biological activity.
Formula:C14H12F3NO
InChI:InChI=1S/C14H12F3NO/c1-18-8-9-6-10(15)2-4-13(9)19-14-5-3-11(16)7-12(14)17/h2-7,18H,8H2,1H3
InChI key:InChIKey=MFAJRYWQXVCHHW-UHFFFAOYSA-N
SMILES:O(C1=C(CNC)C=C(F)C=C1)C2=C(F)C=C(F)C=C2
Synonyms:- 2-(2,4-Difluorophenoxy)-5-fluoro-N-methylbenzenemethanamine
- Benzenemethanamine, 2-(2,4-difluorophenoxy)-5-fluoro-N-methyl-
- 2-(2,4-DIFLUOROPHENOXY)-5-FLUORO-N-METHYLBENZYLAMINE
- 1-[2-(2,4-difluorophenoxy)-5-fluorophenyl]-N-methylmethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.