CAS 902836-75-3
:N-Ethyl-2-(3-piperidinyloxy)acetamide
Description:
N-Ethyl-2-(3-piperidinyloxy)acetamide is a chemical compound characterized by its unique structure, which includes an ethyl group and a piperidine moiety. This compound features a piperidinyloxy group, which contributes to its potential biological activity, particularly in pharmacological applications. It is typically a white to off-white solid at room temperature and is soluble in organic solvents, which is common for amides. The presence of the piperidine ring suggests that it may interact with various biological targets, making it of interest in medicinal chemistry. Its molecular structure allows for hydrogen bonding, which can influence its solubility and reactivity. Additionally, the compound may exhibit properties such as moderate lipophilicity, which can affect its absorption and distribution in biological systems. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, N-Ethyl-2-(3-piperidinyloxy)acetamide represents a class of compounds that may have significant implications in drug development and therapeutic applications.
Formula:C9H18N2O2
InChI:InChI=1/C9H18N2O2/c1-2-11-9(12)7-13-8-4-3-5-10-6-8/h8,10H,2-7H2,1H3,(H,11,12)
InChI key:InChIKey=JGCONOWJRQLSGE-UHFFFAOYSA-N
SMILES:O(CC(NCC)=O)C1CCCNC1
Synonyms:- N-Ethyl-2-(3-piperidinyloxy)acetamide
- N-Ethyl-2-(piperidin-3-yloxy)acetamide
- acetamide, N-ethyl-2-(3-piperidinyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
