CAS 902836-82-2
:2-(4-Chlorophenoxy)-6-fluorobenzaldehyde
Description:
2-(4-Chlorophenoxy)-6-fluorobenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and substituents that enhance its chemical properties. The presence of a chlorophenoxy group indicates that it has a chlorine atom attached to a phenyl ring, which can influence its reactivity and solubility. The fluorine atom, located on the benzene ring, contributes to the compound's electronic properties, potentially affecting its polarity and interaction with other molecules. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique structure allows for specific interactions in biological systems, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the presence of the electron-withdrawing groups (chlorine and fluorine), which can affect its behavior in various chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C13H8ClFO2
InChI:InChI=1/C13H8ClFO2/c14-9-4-6-10(7-5-9)17-13-3-1-2-12(15)11(13)8-16/h1-8H
SMILES:c1cc(c(C=O)c(c1)Oc1ccc(cc1)Cl)F
Synonyms:- Benzaldehyde, 2-(4-Chlorophenoxy)-6-Fluoro-
- 2-(4-chlorophenoxy)-6-fluorobenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(4-Chlorophenoxy)-6-fluorobenzaldehyde, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C13H8ClFO2Purity:98%Molecular weight:250.652-(4-Chlorophenoxy)-6-fluorobenzaldehyde
CAS:<p>2-(4-Chlorophenoxy)-6-fluorobenzaldehyde</p>Purity:≥95%Molecular weight:250.65g/mol
