CymitQuimica logo

CAS 902836-83-3

:

2-(4-Chlorophenoxy)-6-fluoro-N-methylbenzenemethanamine

Description:
2-(4-Chlorophenoxy)-6-fluoro-N-methylbenzenemethanamine, with the CAS number 902836-83-3, is a chemical compound that belongs to the class of amines. This substance features a complex structure characterized by the presence of a chlorophenoxy group and a fluorine atom, which contribute to its unique chemical properties. The presence of the N-methyl group indicates that it is a tertiary amine, which can influence its solubility and reactivity. The compound is likely to exhibit moderate polarity due to the combination of aromatic rings and functional groups, which may affect its interactions in biological systems. Additionally, the chlorophenoxy and fluoro substituents can enhance its biological activity, potentially making it relevant in pharmaceutical applications. Its synthesis and handling require standard laboratory safety protocols, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound's specific characteristics, including its molecular weight, melting point, and solubility, would be essential for understanding its applications and behavior in various chemical contexts.
Formula:C14H13ClFNO
InChI:InChI=1S/C14H13ClFNO/c1-17-9-12-13(16)3-2-4-14(12)18-11-7-5-10(15)6-8-11/h2-8,17H,9H2,1H3
InChI key:InChIKey=BODUZKATGHNYGG-UHFFFAOYSA-N
SMILES:O(C1=C(CNC)C(F)=CC=C1)C2=CC=C(Cl)C=C2
Synonyms:
  • 1-[2-(4-chlorophenoxy)-6-fluorophenyl]-N-methylmethanamine
  • 2-(4-Chlorophenoxy)-6-fluoro-N-methylbenzenemethanamine
  • benzenemethanamine, 2-(4-chlorophenoxy)-6-fluoro-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.