CymitQuimica logo

CAS 902836-93-5

:

3-(3-Piperidinyloxy)benzonitrile

Description:
3-(3-Piperidinyloxy)benzonitrile, identified by its CAS number 902836-93-5, is a chemical compound characterized by its unique structure, which includes a benzonitrile moiety and a piperidinyloxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the piperidine ring suggests that it may interact with biological systems, possibly acting as a ligand for various receptors or enzymes. The nitrile functional group can influence the compound's polarity and solubility, affecting its behavior in different solvents. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in research related to neuropharmacology or other fields where piperidine derivatives are relevant. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H14N2O
InChI:InChI=1S/C12H14N2O/c13-8-10-3-1-4-11(7-10)15-12-5-2-6-14-9-12/h1,3-4,7,12,14H,2,5-6,9H2
InChI key:InChIKey=OSURJDMYHKQISX-UHFFFAOYSA-N
SMILES:O(C1=CC(C#N)=CC=C1)C2CCCNC2
Synonyms:
  • 3-(3-Piperidinyloxy)benzonitrile
  • Benzonitrile, 3-(3-Piperidinyloxy)-
Found 4 products.