CAS 902836-94-6
:2-(2,4-Difluorophenoxy)benzaldehyde
Description:
2-(2,4-Difluorophenoxy)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a difluorophenoxy substituent. The presence of the aldehyde group (-CHO) indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation. The difluorophenoxy moiety contributes to the compound's unique electronic properties and can influence its reactivity and solubility. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The presence of fluorine atoms often enhances the lipophilicity and metabolic stability of compounds, making them of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C13H8F2O2
InChI:InChI=1S/C13H8F2O2/c14-10-5-6-13(11(15)7-10)17-12-4-2-1-3-9(12)8-16/h1-8H
InChI key:InChIKey=KBOXPPHAHQVPHS-UHFFFAOYSA-N
SMILES:O(C1=C(C=O)C=CC=C1)C2=C(F)C=C(F)C=C2
Synonyms:- Benzaldehyde, 2-(2,4-difluorophenoxy)-
- 2-(2,4-Difluorophenoxy)benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.