CymitQuimica logo

CAS 902837-00-7

:

4-(2-formylphenoxy)benzenesulfonamide

Description:
4-(2-Formylphenoxy)benzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The structure features a phenyl ring substituted with a formyl group and a phenoxy linkage, contributing to its potential reactivity and biological activity. This compound may exhibit properties such as solubility in polar solvents, depending on the specific substituents and their interactions. The presence of the sulfonamide group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's molecular structure may influence its interactions with biological targets, making it of interest in drug design and development. Its CAS number, 902837-00-7, allows for easy identification and retrieval of information related to its synthesis, properties, and applications in scientific literature. Overall, 4-(2-formylphenoxy)benzenesulfonamide represents a class of compounds that may have significant implications in both research and therapeutic contexts.
Formula:C13H11NO4S
InChI:InChI=1/C13H11NO4S/c14-19(16,17)12-7-5-11(6-8-12)18-13-4-2-1-3-10(13)9-15/h1-9H,(H2,14,16,17)
SMILES:c1ccc(c(c1)C=O)Oc1ccc(cc1)S(=O)(=O)N
Synonyms:
  • Benzenesulfonamide, 4-(2-Formylphenoxy)-
  • 2-(4-Sulfonamidephenoxy)-Benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.