CAS 902837-06-3
:1-(3-Chloro-2-pyridinyl)hexahydro-1H-1,4-diazepine
Description:
1-(3-Chloro-2-pyridinyl)hexahydro-1H-1,4-diazepine is a chemical compound characterized by its unique structure, which includes a hexahydro-1H-1,4-diazepine ring fused with a pyridine moiety substituted at the 3-position with a chlorine atom. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, including potential biological activity due to the presence of the pyridine ring, which is known for its role in various pharmacological applications. The hexahydro-1H-1,4-diazepine structure contributes to its potential as a ligand in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. Additionally, the presence of the chlorine atom may influence its lipophilicity and interaction with biological targets. As with many chemical substances, safety data and handling precautions should be considered, especially regarding its potential toxicity and environmental impact.
Formula:C10H14ClN3
InChI:InChI=1S/C10H14ClN3/c11-9-3-1-5-13-10(9)14-7-2-4-12-6-8-14/h1,3,5,12H,2,4,6-8H2
InChI key:InChIKey=CYHSXTLNQKPUQO-UHFFFAOYSA-N
SMILES:ClC1=C(N2CCCNCC2)N=CC=C1
Synonyms:- 1-(3-Chloro-2-pyridinyl)hexahydro-1H-1,4-diazepine
- 1H-1,4-Diazepine, 1-(3-chloro-2-pyridinyl)hexahydro-
- 1-(3-Chloropyridin-2-yl)-1,4-diazepane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
