CAS 902837-20-1

1-[4-(Propylamino)-1-piperidinyl]ethanone

Description:

1-[4-(Propylamino)-1-piperidinyl]ethanone, identified by its CAS number 902837-20-1, is a chemical compound that features a piperidine ring substituted with a propylamino group and an ethanone moiety. This structure suggests that it may exhibit properties typical of both amines and ketones, potentially influencing its reactivity and interactions. The presence of the piperidine ring indicates that the compound may have basic characteristics, which could contribute to its solubility in polar solvents. Additionally, the propylamino group may enhance its lipophilicity, affecting its pharmacokinetic properties if it is studied in a biological context. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system or other biological pathways. However, specific biological activity, toxicity, and stability would require empirical investigation to fully characterize its behavior in various environments. As with any chemical substance, safety data and handling precautions should be consulted before use.

Formula: C₁₀H₂₀N₂O

InChI: InChI=1S/C10H20N2O/c1-3-6-11-10-4-7-12(8-5-10)9(2)13/h10-11H,3-8H2,1-2H3

InChI key: InChIKey=APDNHNPNHUQQSZ-UHFFFAOYSA-N

SMILES: C(C)(=O)N1CCC(NCCC)CC1

Synonyms:

• 1-[4-(Propylamino)-1-piperidinyl]ethanone
• Ethanone, 1-[4-(propylamino)-1-piperidinyl]-