CymitQuimica logo

CAS 902837-22-3

:

3-(3-Ethyl-1,2,4-oxadiazol-5-yl)benzoic acid

Description:
3-(3-Ethyl-1,2,4-oxadiazol-5-yl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety and a 1,2,4-oxadiazole ring. The presence of the oxadiazole ring contributes to its potential biological activity, as oxadiazoles are known for their diverse pharmacological properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, which is common for many aromatic carboxylic acids. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. The compound may also display interesting thermal and chemical stability, making it suitable for various synthetic applications. Additionally, the ethyl substituent on the oxadiazole ring can influence its reactivity and interaction with biological targets. Overall, 3-(3-Ethyl-1,2,4-oxadiazol-5-yl)benzoic acid represents a valuable compound for research in organic synthesis and drug development.
Formula:C11H10N2O3
InChI:InChI=1S/C11H10N2O3/c1-2-9-12-10(16-13-9)7-4-3-5-8(6-7)11(14)15/h3-6H,2H2,1H3,(H,14,15)
InChI key:InChIKey=UDGPERFBSLKMSD-UHFFFAOYSA-N
SMILES:C(C)C=1N=C(ON1)C2=CC(C(O)=O)=CC=C2
Synonyms:
  • Benzoic acid, 3-(3-ethyl-1,2,4-oxadiazol-5-yl)-
  • 3-(3-Ethyl-1,2,4-oxadiazol-5-yl)benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.