CAS 902837-24-5

1,1-Dimethylethyl 3-[3-(1-methylethyl)-1,2,4-oxadiazol-5-yl]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-[3-(1-methylethyl)-1,2,4-oxadiazol-5-yl]-1-piperidinecarboxylate, identified by its CAS number 902837-24-5, is a chemical compound characterized by its complex structure, which includes a piperidine ring and an oxadiazole moiety. This compound typically exhibits properties associated with both heterocyclic and aliphatic compounds, potentially influencing its solubility, stability, and reactivity. The presence of the dimethyl group suggests steric hindrance, which may affect its interaction with biological targets or other chemical species. Additionally, the oxadiazole ring is known for its potential biological activity, often contributing to the compound's pharmacological properties. The ester functional group in the piperidinecarboxylate portion may also play a role in its reactivity and solubility in various solvents. Overall, this compound's unique structural features may render it of interest in medicinal chemistry and material science, although specific applications would depend on further research and characterization.

Formula: C₁₅H₂₅N₃O₃

InChI: InChI=1S/C15H25N3O3/c1-10(2)12-16-13(21-17-12)11-7-6-8-18(9-11)14(19)20-15(3,4)5/h10-11H,6-9H2,1-5H3

InChI key: InChIKey=OQXRKRVNELPYRO-UHFFFAOYSA-N

SMILES: C(C)(C)C=1N=C(ON1)C2CN(C(OC(C)(C)C)=O)CCC2

Synonyms:

• 1-Piperidinecarboxylic acid, 3-[3-(1-methylethyl)-1,2,4-oxadiazol-5-yl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-[3-(1-methylethyl)-1,2,4-oxadiazol-5-yl]-1-piperidinecarboxylate

1-BOC-3-(3-ISOPROPYL-1,2,4-OXADIAZOL-5-YL)PIPERIDINE

CAS: 902837-24-5

Formula: C₁₅H₂₅N₃O₃

Purity: 97.0%

Molecular weight: 295.383

Ref: 10-F471069