CAS 902837-28-9
:3-(2-Methylphenoxy)piperidine
Description:
3-(2-Methylphenoxy)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The structure features a 2-methylphenoxy group, indicating that a phenol derivative with a methyl substituent is attached to the piperidine at the third position. This compound is typically classified as an amine due to the presence of the nitrogen atom in the piperidine ring. It may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological systems, making it of interest in medicinal chemistry and drug development. The presence of the aromatic ring can contribute to its lipophilicity, influencing its pharmacokinetic properties. Additionally, the specific arrangement of substituents can affect its reactivity and interaction with various receptors or enzymes. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C12H17NO
InChI:InChI=1S/C12H17NO/c1-10-5-2-3-7-12(10)14-11-6-4-8-13-9-11/h2-3,5,7,11,13H,4,6,8-9H2,1H3
InChI key:InChIKey=YJSMDJHWELLBBO-UHFFFAOYSA-N
SMILES:O(C1=C(C)C=CC=C1)C2CCCNC2
Synonyms:- Piperidine, 3-(2-Methylphenoxy)-
- 3-(2-Methylphenoxy)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
