CAS 902837-30-3
:3-(2-Chloro-5-methylphenoxy)piperidine
Description:
3-(2-Chloro-5-methylphenoxy)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The compound features a phenoxy group, specifically a 2-chloro-5-methylphenyl moiety, indicating the presence of a chlorine atom and a methyl group on the aromatic ring. This structure contributes to its potential biological activity and solubility properties. The presence of the chlorine atom can enhance lipophilicity, while the piperidine ring may influence its interaction with biological targets, such as receptors or enzymes. The compound is likely to be a solid at room temperature and may exhibit moderate stability under standard conditions. Its specific applications and reactivity would depend on its functional groups and overall molecular structure, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H16ClNO
InChI:InChI=1S/C12H16ClNO/c1-9-4-5-11(13)12(7-9)15-10-3-2-6-14-8-10/h4-5,7,10,14H,2-3,6,8H2,1H3
InChI key:InChIKey=GRLVAJJXUNOVRA-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C=CC(C)=C1)C2CCCNC2
Synonyms:- 3-(2-Chloro-5-methylphenoxy)piperidine
- Piperidine, 3-(2-chloro-5-methylphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.