CAS 902837-35-8
:3-[2-(1-Methylethyl)phenoxy]piperidine
Description:
3-[2-(1-Methylethyl)phenoxy]piperidine, identified by its CAS number 902837-35-8, is a chemical compound that features a piperidine ring substituted with a phenoxy group. The presence of the isopropyl group (1-methylethyl) on the phenyl ring contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound is likely to exhibit moderate to high lipophilicity due to the bulky isopropyl substituent, which can affect its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME). The piperidine moiety may impart basic properties, allowing for potential interactions with biological targets, particularly in medicinal chemistry contexts. Additionally, the compound's structure suggests potential applications in drug development, particularly in areas targeting the central nervous system or other therapeutic areas where piperidine derivatives are known to be effective. However, specific biological activity, toxicity, and detailed physicochemical properties would require further investigation through experimental studies.
Formula:C14H21NO
InChI:InChI=1S/C14H21NO/c1-11(2)13-7-3-4-8-14(13)16-12-6-5-9-15-10-12/h3-4,7-8,11-12,15H,5-6,9-10H2,1-2H3
InChI key:InChIKey=DFJMRKMGDKDNAX-UHFFFAOYSA-N
SMILES:O(C1=C(C(C)C)C=CC=C1)C2CCCNC2
Synonyms:- 3-[2-(1-Methylethyl)phenoxy]piperidine
- Piperidine, 3-[2-(1-methylethyl)phenoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.