CymitQuimica logo

CAS 902837-36-9

:

3-(2-Ethoxyphenoxy)piperidine

Description:
3-(2-Ethoxyphenoxy)piperidine is an organic compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a phenoxy group, specifically a 2-ethoxy-substituted phenyl moiety, attached to the piperidine ring. The presence of the ethoxy group enhances its solubility in organic solvents and may influence its biological activity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperidine's role in various biological processes. Additionally, the compound may exhibit properties such as moderate polarity and the ability to form hydrogen bonds, which can affect its interaction with biological targets. As with many organic compounds, its stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended use. Overall, 3-(2-Ethoxyphenoxy)piperidine represents a compound of interest for further research in chemical and pharmaceutical applications.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c1-2-15-12-7-3-4-8-13(12)16-11-6-5-9-14-10-11/h3-4,7-8,11,14H,2,5-6,9-10H2,1H3
InChI key:InChIKey=FHQAQESFJQHBCG-UHFFFAOYSA-N
SMILES:O(C1=C(OCC)C=CC=C1)C2CCCNC2
Synonyms:
  • Piperidine, 3-(2-ethoxyphenoxy)-
  • 3-(2-Ethoxyphenoxy)piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.