CAS 902837-40-5

6-Bromo-2-chloro-1,8-naphthyridine

Description:

6-Bromo-2-chloro-1,8-naphthyridine is a heterocyclic organic compound characterized by its fused bicyclic structure, which includes a naphthyridine moiety. This compound features both bromine and chlorine substituents, which can significantly influence its chemical reactivity and physical properties. Typically, such halogenated naphthyridines exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The presence of the bromine and chlorine atoms can enhance lipophilicity and alter the compound's electronic properties, potentially affecting its interaction with biological targets. Additionally, 6-Bromo-2-chloro-1,8-naphthyridine may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the reactivity of the halogen substituents. Its unique structure and substituents may also allow for the synthesis of derivatives with tailored properties for specific applications in pharmaceuticals or agrochemicals. As with many heterocycles, the compound's solubility, stability, and reactivity can vary based on the solvent and environmental conditions.

Formula: C₈H₄BrClN₂

InChI: InChI=1/C8H4BrClN2/c9-7-2-1-5-3-6(10)4-11-8(5)12-7/h1-4H

SMILES: c1cc(Br)nc2c1cc(cn2)Cl

Synonyms:

• 2-Bromo-6-Chloro-1,8-Naphthyridine

6-Bromo-2-chloro-1,8-naphthyridine, 96%

CAS: 902837-40-5

6-Bromo-2-chloro-1,8-naphthyridine, is used as raw material for synthesis of pharmaceutical intermediates. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa

Formula: C₈H₄BrClN₂

Purity: 96%

Color and Shape: Yellow to brown, Powder

Molecular weight: 243.49

Ref: 02-H50043

6-bromo-2-chloro-1,8-naphthyridine

CAS: 902837-40-5

Formula: C₈H₄BrClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 243.4878

Ref: IN-DA003N3P

6-Bromo-2-chloro-1,8-naphthyridine

CAS: 902837-40-5

6-Bromo-2-chloro-1,8-naphthyridine

Purity: 99%

Molecular weight: 243.49g/mol

Ref: 54-OR93824

6-Bromo-2-chloro-1,8-naphthyridine

CAS: 902837-40-5

Formula: C₈H₄BrClN₂

Purity: 98%

Molecular weight: 243.49

Ref: 10-F211832